C9H7ClN8S — CID 80922564
[5-chloro-4-(7H-purin-6-ylsulfanyl)pyrimidin-2-yl]hydrazine (PubChem CID 80922564) has the molecular formula C9H7ClN8S and a molecular weight of 294.73 g/mol. Its IUPAC name is [5-chloro-4-(7H-purin-6-ylsulfanyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-chloro-4-(7H-purin-6-ylsulfanyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80922564 |
| Molecular Formula | C9H7ClN8S |
| Molecular Weight | 294.73 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | [5-chloro-4-(7H-purin-6-ylsulfanyl)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(Cl)c(Sc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C9H7ClN8S/c10-4-1-12-9(18-11)17-7(4)19-8-5-6(14-2-13-5)15-3-16-8/h1-3H,11H2,(H,12,17,18)(H,13,14,15,16) |
| InChIKey | YBUWMVVUFAEUHK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|