C7H8ClN7S — CID 80923061
[5-chloro-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-yl]hydrazine (PubChem CID 80923061) has the molecular formula C7H8ClN7S and a molecular weight of 257.71 g/mol. Its IUPAC name is [5-chloro-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-yl]hydrazine.
| Compound Name | [5-chloro-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80923061 |
| Molecular Formula | C7H8ClN7S |
| Molecular Weight | 257.71 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | [5-chloro-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrimidin-2-yl]hydrazine |
| SMILES | Cc1nc(Sc2nc(NN)ncc2Cl)n[nH]1 |
| InChI | InChI=1S/C7H8ClN7S/c1-3-11-7(15-14-3)16-5-4(8)2-10-6(12-5)13-9/h2H,9H2,1H3,(H,10,12,13)(H,11,14,15) |
| InChIKey | PLCGOIWWFZFQGP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.71 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|