C9H10ClN7OS — CID 80929223
3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one (PubChem CID 80929223) has the molecular formula C9H10ClN7OS and a molecular weight of 299.75 g/mol. Its IUPAC name is 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 80929223 |
| Molecular Formula | C9H10ClN7OS |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one |
| SMILES | NNc1ncc(Cl)c(Sc2n[nH]c(=O)n2C2CC2)n1 |
| InChI | InChI=1S/C9H10ClN7OS/c10-5-3-12-7(14-11)13-6(5)19-9-16-15-8(18)17(9)4-1-2-4/h3-4H,1-2,11H2,(H,15,18)(H,12,13,14) |
| InChIKey | QVDJPCMQEUXBJS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|