C11H11ClN4OS — CID 104835606
3-(2-amino-3-chlorophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one (PubChem CID 104835606) has the molecular formula C11H11ClN4OS and a molecular weight of 282.76 g/mol. Its IUPAC name is 3-(2-amino-3-chlorophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2-amino-3-chlorophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 104835606 |
| Molecular Formula | C11H11ClN4OS |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-(2-amino-3-chlorophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one |
| SMILES | Nc1c(Cl)cccc1Sc1n[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C11H11ClN4OS/c12-7-2-1-3-8(9(7)13)18-11-15-14-10(17)16(11)6-4-5-6/h1-3,6H,4-5,13H2,(H,14,17) |
| InChIKey | FBPRSEMIMFHFNB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|