C11H12N6O3S — CID 80928909
4-cyclopropyl-3-(3-hydrazinyl-2-nitrophenyl)sulfanyl-1H-1,2,4-triazol-5-one (PubChem CID 80928909) has the molecular formula C11H12N6O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-cyclopropyl-3-(3-hydrazinyl-2-nitrophenyl)sulfanyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-cyclopropyl-3-(3-hydrazinyl-2-nitrophenyl)sulfanyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 80928909 |
| Molecular Formula | C11H12N6O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-cyclopropyl-3-(3-hydrazinyl-2-nitrophenyl)sulfanyl-1H-1,2,4-triazol-5-one |
| SMILES | NNc1cccc(Sc2n[nH]c(=O)n2C2CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N6O3S/c12-13-7-2-1-3-8(9(7)17(19)20)21-11-15-14-10(18)16(11)6-4-5-6/h1-3,6,13H,4-5,12H2,(H,14,18) |
| InChIKey | URGICRTXOSTFND-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|