C12H13N5O3S — CID 107352732
3-[(2-amino-3-nitrophenyl)methylsulfanyl]-4-cyclopropyl-1H-1,2,4-triazol-5-one (PubChem CID 107352732) has the molecular formula C12H13N5O3S and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-[(2-amino-3-nitrophenyl)methylsulfanyl]-4-cyclopropyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(2-amino-3-nitrophenyl)methylsulfanyl]-4-cyclopropyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 107352732 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-[(2-amino-3-nitrophenyl)methylsulfanyl]-4-cyclopropyl-1H-1,2,4-triazol-5-one |
| SMILES | Nc1c(CSc2n[nH]c(=O)n2C2CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N5O3S/c13-10-7(2-1-3-9(10)17(19)20)6-21-12-15-14-11(18)16(12)8-4-5-8/h1-3,8H,4-6,13H2,(H,14,18) |
| InChIKey | KPHMDNQUSHAANW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|