C9H7FN4O3S — CID 55128756
3-(3-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 55128756) has the molecular formula C9H7FN4O3S and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-(3-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(3-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 55128756 |
| Molecular Formula | C9H7FN4O3S |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 3-(3-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(Sc2cccc(F)c2[N+](=O)[O-])n[nH]c1=O |
| InChI | InChI=1S/C9H7FN4O3S/c1-13-8(15)11-12-9(13)18-6-4-2-3-5(10)7(6)14(16)17/h2-4H,1H3,(H,11,15) |
| InChIKey | JSJHRCZPPFVRNQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|