C7H8N8O3S — CID 80930259
3-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 80930259) has the molecular formula C7H8N8O3S and a molecular weight of 284.26 g/mol. Its IUPAC name is 3-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 80930259 |
| Molecular Formula | C7H8N8O3S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(Sc2ncnc(NN)c2[N+](=O)[O-])n[nH]c1=O |
| InChI | InChI=1S/C7H8N8O3S/c1-14-6(16)12-13-7(14)19-5-3(15(17)18)4(11-8)9-2-10-5/h2H,8H2,1H3,(H,12,16)(H,9,10,11) |
| InChIKey | BHFOSLGRDFREDD-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 157.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|