C8H10N8O2S2 — CID 80931340
5-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 80931340) has the molecular formula C8H10N8O2S2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 5-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80931340 |
| Molecular Formula | C8H10N8O2S2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-(6-hydrazinyl-5-nitropyrimidin-4-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(Sc2ncnc(NN)c2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H10N8O2S2/c1-15(2)7-13-14-8(20-7)19-6-4(16(17)18)5(12-9)10-3-11-6/h3H,9H2,1-2H3,(H,10,11,12) |
| InChIKey | GUGJSYGCGIBRNM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|