C9H13N5O3S — CID 107766184
[6-(2-methyloxolan-3-yl)sulfanyl-5-nitropyrimidin-4-yl]hydrazine (PubChem CID 107766184) has the molecular formula C9H13N5O3S and a molecular weight of 271.30 g/mol. Its IUPAC name is [6-(2-methyloxolan-3-yl)sulfanyl-5-nitropyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2-methyloxolan-3-yl)sulfanyl-5-nitropyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 107766184 |
| Molecular Formula | C9H13N5O3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | [6-(2-methyloxolan-3-yl)sulfanyl-5-nitropyrimidin-4-yl]hydrazine |
| SMILES | CC1OCCC1Sc1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N5O3S/c1-5-6(2-3-17-5)18-9-7(14(15)16)8(13-10)11-4-12-9/h4-6H,2-3,10H2,1H3,(H,11,12,13) |
| InChIKey | FNONYAYSFCVFSD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|