C9H10N6O3S — CID 106928878
[6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-nitropyrimidin-4-yl]hydrazine (PubChem CID 106928878) has the molecular formula C9H10N6O3S and a molecular weight of 282.28 g/mol. Its IUPAC name is [6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-nitropyrimidin-4-yl]hydrazine.
| Compound Name | [6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-nitropyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106928878 |
| Molecular Formula | C9H10N6O3S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | [6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-5-nitropyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(Sc2ncnc(NN)c2[N+](=O)[O-])oc1C |
| InChI | InChI=1S/C9H10N6O3S/c1-4-5(2)18-9(13-4)19-8-6(15(16)17)7(14-10)11-3-12-8/h3H,10H2,1-2H3,(H,11,12,14) |
| InChIKey | GTFDQGCPIKMRID-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|