C9H9N5O3S — CID 80924591
[6-(furan-2-ylmethylsulfanyl)-5-nitropyrimidin-4-yl]hydrazine (PubChem CID 80924591) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is [6-(furan-2-ylmethylsulfanyl)-5-nitropyrimidin-4-yl]hydrazine.
| Compound Name | [6-(furan-2-ylmethylsulfanyl)-5-nitropyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80924591 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | [6-(furan-2-ylmethylsulfanyl)-5-nitropyrimidin-4-yl]hydrazine |
| SMILES | NNc1ncnc(SCc2ccco2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O3S/c10-13-8-7(14(15)16)9(12-5-11-8)18-4-6-2-1-3-17-6/h1-3,5H,4,10H2,(H,11,12,13) |
| InChIKey | FVAKYIAOSJHZNQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|