C9H9N5O2S2 — CID 113221502
N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine (PubChem CID 113221502) has the molecular formula C9H9N5O2S2 and a molecular weight of 283.34 g/mol. Its IUPAC name is N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine.
| Compound Name | N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 113221502 |
| Molecular Formula | C9H9N5O2S2 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine |
| SMILES | CNc1ncnc(Sc2nc(C)cs2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O2S2/c1-5-3-17-9(13-5)18-8-6(14(15)16)7(10-2)11-4-12-8/h3-4H,1-2H3,(H,10,11,12) |
| InChIKey | PMWKASCCSHXCFU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|