About N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine
N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine (PubChem CID 113221502) has the molecular formula C9H9N5O2S2
and a molecular weight of 283.34 g/mol. Its IUPAC name is N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine.
Molecular Properties
| Compound Name | N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine |
| PubChem CID | 113221502 |
| Molecular Formula | C9H9N5O2S2 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine |
| SMILES | CNc1ncnc(Sc2nc(C)cs2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O2S2/c1-5-3-17-9(13-5)18-8-6(14(15)16)7(10-2)11-4-12-8/h3-4H,1-2H3,(H,10,11,12) |
| InChIKey | PMWKASCCSHXCFU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine?
The IUPAC name of N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine (CID 113221502) is N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine.
What is the SMILES notation for N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine?
The canonical SMILES for N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine is CNc1ncnc(Sc2nc(C)cs2)c1[N+](=O)[O-].
What is the InChIKey of N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine?
The InChIKey is PMWKASCCSHXCFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5O2S2/c1-5-3-17-9(13-5)18-8-6(14(15)16)7(10-2)11-4-12-8/h3-4H,1-2H3,(H,10,11,12).
What are the key properties of N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine?
N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine has a molecular weight of 283.34 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine is sourced from PubChem (CID 113221502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).