C9H11N7O2S2 — CID 80882840
N,N-dimethyl-5-[6-(methylamino)-5-nitropyrimidin-4-yl]sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 80882840) has the molecular formula C9H11N7O2S2 and a molecular weight of 313.37 g/mol. Its IUPAC name is N,N-dimethyl-5-[6-(methylamino)-5-nitropyrimidin-4-yl]sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N,N-dimethyl-5-[6-(methylamino)-5-nitropyrimidin-4-yl]sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80882840 |
| Molecular Formula | C9H11N7O2S2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N,N-dimethyl-5-[6-(methylamino)-5-nitropyrimidin-4-yl]sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1ncnc(Sc2nnc(N(C)C)s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N7O2S2/c1-10-6-5(16(17)18)7(12-4-11-6)19-9-14-13-8(20-9)15(2)3/h4H,1-3H3,(H,10,11,12) |
| InChIKey | CRLOWDOFYRMFTM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|