C10H12N6O2S2 — CID 80883841
N,N-dimethyl-5-[[6-(methylamino)-3-nitro-2-pyridinyl]sulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 80883841) has the molecular formula C10H12N6O2S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is N,N-dimethyl-5-[[6-(methylamino)-3-nitro-2-pyridinyl]sulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N,N-dimethyl-5-[[6-(methylamino)-3-nitro-2-pyridinyl]sulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80883841 |
| Molecular Formula | C10H12N6O2S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N,N-dimethyl-5-[[6-(methylamino)-3-nitro-2-pyridinyl]sulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1ccc([N+](=O)[O-])c(Sc2nnc(N(C)C)s2)n1 |
| InChI | InChI=1S/C10H12N6O2S2/c1-11-7-5-4-6(16(17)18)8(12-7)19-10-14-13-9(20-10)15(2)3/h4-5H,1-3H3,(H,11,12) |
| InChIKey | OMAYERRLCQTHKK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|