C10H11N5O2S2 — CID 80883642
5-(3-amino-5-nitrophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 80883642) has the molecular formula C10H11N5O2S2 and a molecular weight of 297.37 g/mol. Its IUPAC name is 5-(3-amino-5-nitrophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-amino-5-nitrophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80883642 |
| Molecular Formula | C10H11N5O2S2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-(3-amino-5-nitrophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(Sc2cc(N)cc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C10H11N5O2S2/c1-14(2)9-12-13-10(19-9)18-8-4-6(11)3-7(5-8)15(16)17/h3-5H,11H2,1-2H3 |
| InChIKey | SRCWUWJROVHELI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|