C13H13N3O2S — CID 102926909
3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-nitroaniline (PubChem CID 102926909) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-nitroaniline.
| Compound Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-nitroaniline |
|---|---|
| PubChem CID | 102926909 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-nitroaniline |
| SMILES | Cc1cc(C)nc(Sc2cc(N)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C13H13N3O2S/c1-8-3-9(2)15-13(4-8)19-12-6-10(14)5-11(7-12)16(17)18/h3-7H,14H2,1-2H3 |
| InChIKey | SOKOMPFBFWGMLC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|