C10H10N4O2S3 — CID 115384349
N-methyl-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitroaniline (PubChem CID 115384349) has the molecular formula C10H10N4O2S3 and a molecular weight of 314.42 g/mol. Its IUPAC name is N-methyl-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitroaniline.
| Compound Name | N-methyl-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitroaniline |
|---|---|
| PubChem CID | 115384349 |
| Molecular Formula | C10H10N4O2S3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | N-methyl-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitroaniline |
| SMILES | CNc1cc(Sc2nnc(SC)s2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10N4O2S3/c1-11-6-3-7(14(15)16)5-8(4-6)18-10-13-12-9(17-2)19-10/h3-5,11H,1-2H3 |
| InChIKey | LHRLPSWWNWDVQU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|