C10H6ClN3O4S3 — CID 107191648
3-chloro-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzoic acid (PubChem CID 107191648) has the molecular formula C10H6ClN3O4S3 and a molecular weight of 363.83 g/mol. Its IUPAC name is 3-chloro-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzoic acid.
| Compound Name | 3-chloro-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 107191648 |
| Molecular Formula | C10H6ClN3O4S3 |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 3-chloro-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzoic acid |
| SMILES | CSc1nnc(Sc2c(Cl)cc([N+](=O)[O-])cc2C(=O)O)s1 |
| InChI | InChI=1S/C10H6ClN3O4S3/c1-19-9-12-13-10(21-9)20-7-5(8(15)16)2-4(14(17)18)3-6(7)11/h2-3H,1H3,(H,15,16) |
| InChIKey | QRIBAYICUFCMLX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|