C10H7ClN4O4S — CID 107191510
3-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzoic acid (PubChem CID 107191510) has the molecular formula C10H7ClN4O4S and a molecular weight of 314.71 g/mol. Its IUPAC name is 3-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzoic acid.
| Compound Name | 3-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 107191510 |
| Molecular Formula | C10H7ClN4O4S |
| Molecular Weight | 314.71 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 3-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzoic acid |
| SMILES | Cn1cnnc1Sc1c(Cl)cc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C10H7ClN4O4S/c1-14-4-12-13-10(14)20-8-6(9(16)17)2-5(15(18)19)3-7(8)11/h2-4H,1H3,(H,16,17) |
| InChIKey | ODUPMDVSNZXZJW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.71 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|