C11H7Cl2N3O2S2 — CID 133485083
2-cyclopropyl-5-(2,6-dichloro-4-nitrophenyl)sulfanyl-1,3,4-thiadiazole (PubChem CID 133485083) has the molecular formula C11H7Cl2N3O2S2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 2-cyclopropyl-5-(2,6-dichloro-4-nitrophenyl)sulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-cyclopropyl-5-(2,6-dichloro-4-nitrophenyl)sulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 133485083 |
| Molecular Formula | C11H7Cl2N3O2S2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 2-cyclopropyl-5-(2,6-dichloro-4-nitrophenyl)sulfanyl-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Sc2nnc(C3CC3)s2)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl2N3O2S2/c12-7-3-6(16(17)18)4-8(13)9(7)19-11-15-14-10(20-11)5-1-2-5/h3-5H,1-2H2 |
| InChIKey | KVNSGHFZDVYRPB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|