C11H10N4O4S2 — CID 104500013
4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-nitrobenzoic acid (PubChem CID 104500013) has the molecular formula C11H10N4O4S2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-nitrobenzoic acid.
| Compound Name | 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 104500013 |
| Molecular Formula | C11H10N4O4S2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-nitrobenzoic acid |
| SMILES | CN(C)c1nnc(Sc2ccc(C(=O)O)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C11H10N4O4S2/c1-14(2)10-12-13-11(21-10)20-6-3-4-7(9(16)17)8(5-6)15(18)19/h3-5H,1-2H3,(H,16,17) |
| InChIKey | NBUOGOONQBDSRD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|