C11H9N3O3S2 — CID 104529956
1-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrophenyl]ethanone (PubChem CID 104529956) has the molecular formula C11H9N3O3S2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrophenyl]ethanone.
| Compound Name | 1-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 104529956 |
| Molecular Formula | C11H9N3O3S2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 1-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(Sc2nnc(C)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9N3O3S2/c1-6(15)9-4-3-8(5-10(9)14(16)17)19-11-13-12-7(2)18-11/h3-5H,1-2H3 |
| InChIKey | YCMATWAYBBNFSY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|