C9H9N3O3S3 — CID 103942461
(1R)-1-[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-4-nitrothiophen-2-yl]ethanol (PubChem CID 103942461) has the molecular formula C9H9N3O3S3 and a molecular weight of 303.39 g/mol. Its IUPAC name is (1R)-1-[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1R)-1-[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103942461 |
| Molecular Formula | C9H9N3O3S3 |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | (1R)-1-[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-4-nitrothiophen-2-yl]ethanol |
| SMILES | Cc1nnc(Sc2sc([C@@H](C)O)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H9N3O3S3/c1-4(13)7-3-6(12(14)15)8(17-7)18-9-11-10-5(2)16-9/h3-4,13H,1-2H3/t4-/m1/s1 |
| InChIKey | TUYMLLVLROSTDJ-SCSAIBSYSA-N |
| XLogP | 3.02 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|