C9H8N2O3S3 — CID 103942508
(1S)-1-[4-nitro-5-(1,3-thiazol-2-ylsulfanyl)thiophen-2-yl]ethanol (PubChem CID 103942508) has the molecular formula C9H8N2O3S3 and a molecular weight of 288.38 g/mol. Its IUPAC name is (1S)-1-[4-nitro-5-(1,3-thiazol-2-ylsulfanyl)thiophen-2-yl]ethanol.
| Compound Name | (1S)-1-[4-nitro-5-(1,3-thiazol-2-ylsulfanyl)thiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103942508 |
| Molecular Formula | C9H8N2O3S3 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | (1S)-1-[4-nitro-5-(1,3-thiazol-2-ylsulfanyl)thiophen-2-yl]ethanol |
| SMILES | C[C@H](O)c1cc([N+](=O)[O-])c(Sc2nccs2)s1 |
| InChI | InChI=1S/C9H8N2O3S3/c1-5(12)7-4-6(11(13)14)8(16-7)17-9-10-2-3-15-9/h2-5,12H,1H3/t5-/m0/s1 |
| InChIKey | YYIXFSPETFOKTO-YFKPBYRVSA-N |
| XLogP | 3.32 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|