C9H9N3O3S2 — CID 107783427
(1S)-1-[5-(1H-imidazol-2-ylsulfanyl)-4-nitrothiophen-2-yl]ethanol (PubChem CID 107783427) has the molecular formula C9H9N3O3S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (1S)-1-[5-(1H-imidazol-2-ylsulfanyl)-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1S)-1-[5-(1H-imidazol-2-ylsulfanyl)-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 107783427 |
| Molecular Formula | C9H9N3O3S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | (1S)-1-[5-(1H-imidazol-2-ylsulfanyl)-4-nitrothiophen-2-yl]ethanol |
| SMILES | C[C@H](O)c1cc([N+](=O)[O-])c(Sc2ncc[nH]2)s1 |
| InChI | InChI=1S/C9H9N3O3S2/c1-5(13)7-4-6(12(14)15)8(16-7)17-9-10-2-3-11-9/h2-5,13H,1H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | FFUNPHKSSZBSBJ-YFKPBYRVSA-N |
| XLogP | 2.58 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|