C10H12N4O4S2 — CID 103942481
4-ethyl-3-[5-[(1S)-1-hydroxyethyl]-3-nitrothiophen-2-yl]sulfanyl-1H-1,2,4-triazol-5-one (PubChem CID 103942481) has the molecular formula C10H12N4O4S2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-ethyl-3-[5-[(1S)-1-hydroxyethyl]-3-nitrothiophen-2-yl]sulfanyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-ethyl-3-[5-[(1S)-1-hydroxyethyl]-3-nitrothiophen-2-yl]sulfanyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 103942481 |
| Molecular Formula | C10H12N4O4S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-ethyl-3-[5-[(1S)-1-hydroxyethyl]-3-nitrothiophen-2-yl]sulfanyl-1H-1,2,4-triazol-5-one |
| SMILES | CCn1c(Sc2sc([C@H](C)O)cc2[N+](=O)[O-])n[nH]c1=O |
| InChI | InChI=1S/C10H12N4O4S2/c1-3-13-9(16)11-12-10(13)20-8-6(14(17)18)4-7(19-8)5(2)15/h4-5,15H,3H2,1-2H3,(H,11,16)/t5-/m0/s1 |
| InChIKey | NYCOMSYCPMSYHP-YFKPBYRVSA-N |
| XLogP | 1.77 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|