C9H10N4O4S2 — CID 112623515
3-[5-(1-hydroxyethyl)-3-nitrothiophen-2-yl]sulfanyl-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 112623515) has the molecular formula C9H10N4O4S2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-[5-(1-hydroxyethyl)-3-nitrothiophen-2-yl]sulfanyl-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[5-(1-hydroxyethyl)-3-nitrothiophen-2-yl]sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 112623515 |
| Molecular Formula | C9H10N4O4S2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 3-[5-(1-hydroxyethyl)-3-nitrothiophen-2-yl]sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | CC(O)c1cc([N+](=O)[O-])c(Sc2n[nH]c(=O)n2C)s1 |
| InChI | InChI=1S/C9H10N4O4S2/c1-4(14)6-3-5(13(16)17)7(18-6)19-9-11-10-8(15)12(9)2/h3-4,14H,1-2H3,(H,10,15) |
| InChIKey | VABPKHAATPMRQF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|