About 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde
5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde (PubChem CID 114057943) has the molecular formula C10H7N3O3S2
and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde.
Molecular Properties
| Compound Name | 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde |
| PubChem CID | 114057943 |
| Molecular Formula | C10H7N3O3S2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde |
| SMILES | Cc1nnc(Sc2ccc([N+](=O)[O-])c(C=O)c2)s1 |
| InChI | InChI=1S/C10H7N3O3S2/c1-6-11-12-10(17-6)18-8-2-3-9(13(15)16)7(4-8)5-14/h2-5H,1H3 |
| InChIKey | KYNGNVNUCDYRBY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde?
The IUPAC name of 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde (CID 114057943) is 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde.
What is the SMILES notation for 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde?
The canonical SMILES for 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde is Cc1nnc(Sc2ccc([N+](=O)[O-])c(C=O)c2)s1.
What is the InChIKey of 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde?
The InChIKey is KYNGNVNUCDYRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O3S2/c1-6-11-12-10(17-6)18-8-2-3-9(13(15)16)7(4-8)5-14/h2-5H,1H3.
What are the key properties of 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde?
5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde has a molecular weight of 281.32 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitrobenzaldehyde is sourced from PubChem (CID 114057943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).