C19H11N3O4S2 — CID 4019990
2-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methylidene]indene-1,3-dione (PubChem CID 4019990) has the molecular formula C19H11N3O4S2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 4019990 |
| Molecular Formula | C19H11N3O4S2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 2-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methylidene]indene-1,3-dione |
| SMILES | Cc1nnc(Sc2ccc(C=C3C(=O)c4ccccc4C3=O)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C19H11N3O4S2/c1-10-20-21-19(27-10)28-16-7-6-11(9-15(16)22(25)26)8-14-17(23)12-4-2-3-5-13(12)18(14)24/h2-9H,1H3 |
| InChIKey | PPURCYQDNCMSEO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 103.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|