C34H21N5O6S3 — CID 126001227
2-[2-[4-[(E)-[1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione (PubChem CID 126001227) has the molecular formula C34H21N5O6S3 and a molecular weight of 691.77 g/mol. Its IUPAC name is 2-[2-[4-[(E)-[1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[(E)-[1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 126001227 |
| Molecular Formula | C34H21N5O6S3 |
| Molecular Weight | 691.77 g/mol |
| Exact Mass | 691.07 |
| IUPAC Name | 2-[2-[4-[(E)-[1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3ccc(Sc4nc5ccc(N6C(=O)c7ccccc7C6=O)cc5s4)c([N+](=O)[O-])c3)C(=O)NC2=S)cc1C |
| InChI | InChI=1S/C34H21N5O6S3/c1-17-7-9-20(13-18(17)2)38-32(43)24(29(40)36-33(38)46)14-19-8-12-27(26(15-19)39(44)45)47-34-35-25-11-10-21(16-28(25)48-34)37-30(41)22-5-3-4-6-23(22)31(37)42/h3-16H,1-2H3,(H,36,40,46)/b24-14+ |
| InChIKey | ZVOJUSXTDIQXHX-ZVHZXABRSA-N |
| XLogP | 6.60 |
| TPSA | 142.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.77 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|