C26H17N5O6S3 — CID 126000285
(5E)-1-(3,4-dimethylphenyl)-5-[[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126000285) has the molecular formula C26H17N5O6S3 and a molecular weight of 591.65 g/mol. Its IUPAC name is (5E)-1-(3,4-dimethylphenyl)-5-[[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(3,4-dimethylphenyl)-5-[[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126000285 |
| Molecular Formula | C26H17N5O6S3 |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.03 |
| IUPAC Name | (5E)-1-(3,4-dimethylphenyl)-5-[[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3ccc(Sc4nc5ccc([N+](=O)[O-])cc5s4)c([N+](=O)[O-])c3)C(=O)NC2=S)cc1C |
| InChI | InChI=1S/C26H17N5O6S3/c1-13-3-5-16(9-14(13)2)29-24(33)18(23(32)28-25(29)38)10-15-4-8-21(20(11-15)31(36)37)39-26-27-19-7-6-17(30(34)35)12-22(19)40-26/h3-12H,1-2H3,(H,28,32,38)/b18-10+ |
| InChIKey | WOWCKZSSPQCBGN-VCHYOVAHSA-N |
| XLogP | 5.71 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|