C26H13N5O7S2 — CID 124531327
5-[[4-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-3-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124531327) has the molecular formula C26H13N5O7S2 and a molecular weight of 571.55 g/mol. Its IUPAC name is 5-[[4-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-3-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-3-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124531327 |
| Molecular Formula | C26H13N5O7S2 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | 5-[[4-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-3-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(Sc3nc4ccc(N5C(=O)c6ccccc6C5=O)cc4s3)c([N+](=O)[O-])c2)C(=O)N1 |
| InChI | InChI=1S/C26H13N5O7S2/c32-21-16(22(33)29-25(36)28-21)9-12-5-8-19(18(10-12)31(37)38)39-26-27-17-7-6-13(11-20(17)40-26)30-23(34)14-3-1-2-4-15(14)24(30)35/h1-11H,(H2,28,29,32,33,36) |
| InChIKey | DSJRGTCQKVDASN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|