C36H23N5O4S3 — CID 126000512
N-[2-[2-nitro-4-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 126000512) has the molecular formula C36H23N5O4S3 and a molecular weight of 685.81 g/mol. Its IUPAC name is N-[2-[2-nitro-4-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | N-[2-[2-nitro-4-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 126000512 |
| Molecular Formula | C36H23N5O4S3 |
| Molecular Weight | 685.81 g/mol |
| Exact Mass | 685.09 |
| IUPAC Name | N-[2-[2-nitro-4-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | O=C(Nc1ccc2nc(Sc3ccc(/C=C4\S/C(=N\c5ccccc5)N(c5ccccc5)C4=O)cc3[N+](=O)[O-])sc2c1)c1ccccc1 |
| InChI | InChI=1S/C36H23N5O4S3/c42-33(24-10-4-1-5-11-24)37-26-17-18-28-31(22-26)48-36(39-28)47-30-19-16-23(20-29(30)41(44)45)21-32-34(43)40(27-14-8-3-9-15-27)35(46-32)38-25-12-6-2-7-13-25/h1-22H,(H,37,42)/b32-21-,38-35- |
| InChIKey | XUDLUWFBSSQGFS-UFNURKCNSA-N |
| XLogP | 9.42 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.81 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|