C27H25N5O4S2 — CID 137172886
(5E)-3-cyclohexyl-5-[[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrophenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 137172886) has the molecular formula C27H25N5O4S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-5-[[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrophenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-5-[[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrophenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137172886 |
| Molecular Formula | C27H25N5O4S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | (5E)-3-cyclohexyl-5-[[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrophenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(=O)[nH]c(Sc2ccc(/C=C3/S/C(=N\c4ccccc4)N(C4CCCCC4)C3=O)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C27H25N5O4S2/c1-17-14-24(33)30-26(28-17)37-22-13-12-18(15-21(22)32(35)36)16-23-25(34)31(20-10-6-3-7-11-20)27(38-23)29-19-8-4-2-5-9-19/h2,4-5,8-9,12-16,20H,3,6-7,10-11H2,1H3,(H,28,30,33)/b23-16+,29-27- |
| InChIKey | GMSUTRLUGXRTTA-RLTFYZJDSA-N |
| XLogP | 6.07 |
| TPSA | 121.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|