C25H26N4OS — CID 118542418
(5Z)-3-cyclohexyl-5-[(1-methylindazol-5-yl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 118542418) has the molecular formula C25H26N4OS and a molecular weight of 430.58 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[(1-methylindazol-5-yl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[(1-methylindazol-5-yl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118542418 |
| Molecular Formula | C25H26N4OS |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[(1-methylindazol-5-yl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\S/C(=C\c3ccc4c(cnn4C)c3)C(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H26N4OS/c1-17-8-11-20(12-9-17)27-25-29(21-6-4-3-5-7-21)24(30)23(31-25)15-18-10-13-22-19(14-18)16-26-28(22)2/h8-16,21H,3-7H2,1-2H3/b23-15-,27-25- |
| InChIKey | SZRYUKJFOQMPIL-KHHYFDFNSA-N |
| XLogP | 5.82 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|