C23H15BrN2O3S — CID 18846546
3-[[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18846546) has the molecular formula C23H15BrN2O3S and a molecular weight of 479.36 g/mol. Its IUPAC name is 3-[[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18846546 |
| Molecular Formula | C23H15BrN2O3S |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 3-[[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(/N=C2\S/C(=C\c3ccc(Br)cc3)C(=O)N2c2ccccc2)c1 |
| InChI | InChI=1S/C23H15BrN2O3S/c24-17-11-9-15(10-12-17)13-20-21(27)26(19-7-2-1-3-8-19)23(30-20)25-18-6-4-5-16(14-18)22(28)29/h1-14H,(H,28,29)/b20-13-,25-23- |
| InChIKey | BOVUCAIERKPBKP-VDJWSQCXSA-N |
| XLogP | 5.96 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|