C27H19N3O3S — CID 126097243
3-[2-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid (PubChem CID 126097243) has the molecular formula C27H19N3O3S and a molecular weight of 465.53 g/mol. Its IUPAC name is 3-[2-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126097243 |
| Molecular Formula | C27H19N3O3S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 3-[2-[(Z)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2cccc2/C=C2\S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C27H19N3O3S/c31-25-24(18-23-15-8-16-29(23)22-14-7-9-19(17-22)26(32)33)34-27(28-20-10-3-1-4-11-20)30(25)21-12-5-2-6-13-21/h1-18H,(H,32,33)/b24-18-,28-27- |
| InChIKey | RCIGCTANQYNIHI-BRHJTBNZSA-N |
| XLogP | 5.98 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|