C27H21N3O5S — CID 126110499
3-[2-[(Z)-[3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid (PubChem CID 126110499) has the molecular formula C27H21N3O5S and a molecular weight of 499.55 g/mol. Its IUPAC name is 3-[2-[(Z)-[3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-[(Z)-[3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126110499 |
| Molecular Formula | C27H21N3O5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3-[2-[(Z)-[3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
| SMILES | COc1ccc(/N=C2\S/C(=C\c3cccn3-c3cccc(C(=O)O)c3)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C27H21N3O5S/c1-34-22-11-9-19(10-12-22)28-27-30(17-23-8-4-14-35-23)25(31)24(36-27)16-21-7-3-13-29(21)20-6-2-5-18(15-20)26(32)33/h2-16H,17H2,1H3,(H,32,33)/b24-16-,28-27- |
| InChIKey | FZTZXMKDMFDRSP-HSIVCTKQSA-N |
| XLogP | 5.58 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|