C24H19N3O6S — CID 94841658
3-[2-[(Z)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid (PubChem CID 94841658) has the molecular formula C24H19N3O6S and a molecular weight of 477.50 g/mol. Its IUPAC name is 3-[2-[(Z)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-[(Z)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 94841658 |
| Molecular Formula | C24H19N3O6S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 3-[2-[(Z)-[3-[2-(4-methoxyanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C\c3cccn3-c3cccc(C(=O)O)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H19N3O6S/c1-33-19-9-7-16(8-10-19)25-21(28)14-27-22(29)20(34-24(27)32)13-18-6-3-11-26(18)17-5-2-4-15(12-17)23(30)31/h2-13H,14H2,1H3,(H,25,28)(H,30,31)/b20-13- |
| InChIKey | LXTUDXIGGAOSQO-MOSHPQCFSA-N |
| XLogP | 3.86 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|