C31H19ClN6O6S3 — CID 137143600
2-chloro-N-[2-[4-[(Z)-[2-(4-methyl-3-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 137143600) has the molecular formula C31H19ClN6O6S3 and a molecular weight of 703.18 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-[(Z)-[2-(4-methyl-3-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | 2-chloro-N-[2-[4-[(Z)-[2-(4-methyl-3-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 137143600 |
| Molecular Formula | C31H19ClN6O6S3 |
| Molecular Weight | 703.18 g/mol |
| Exact Mass | 702.02 |
| IUPAC Name | 2-chloro-N-[2-[4-[(Z)-[2-(4-methyl-3-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(Sc4nc5ccc(NC(=O)c6ccccc6Cl)cc5s4)c([N+](=O)[O-])c3)S2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H19ClN6O6S3/c1-16-6-8-18(14-23(16)37(41)42)34-30-36-29(40)27(45-30)13-17-7-11-25(24(12-17)38(43)44)46-31-35-22-10-9-19(15-26(22)47-31)33-28(39)20-4-2-3-5-21(20)32/h2-15H,1H3,(H,33,39)(H,34,36,40)/b27-13- |
| InChIKey | DCAIULKRGHONRX-WKIKZPBSSA-N |
| XLogP | 8.37 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.18 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|