C25H20N4O4S2 — CID 137035995
2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-N-phenylacetamide (PubChem CID 137035995) has the molecular formula C25H20N4O4S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 137035995 |
| Molecular Formula | C25H20N4O4S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenyl]sulfanyl-N-phenylacetamide |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(SCC(=O)Nc4ccccc4)c([N+](=O)[O-])c3)S2)cc1 |
| InChI | InChI=1S/C25H20N4O4S2/c1-16-7-10-19(11-8-16)27-25-28-24(31)22(35-25)14-17-9-12-21(20(13-17)29(32)33)34-15-23(30)26-18-5-3-2-4-6-18/h2-14H,15H2,1H3,(H,26,30)(H,27,28,31)/b22-14- |
| InChIKey | MGBBUCZEHKTRKR-HMAPJEAMSA-N |
| XLogP | 5.53 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|