C18H15N3O4S — CID 135414153
2-(3,5-dimethylphenyl)imino-5-[(3-hydroxy-4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135414153) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)imino-5-[(3-hydroxy-4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(3,5-dimethylphenyl)imino-5-[(3-hydroxy-4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135414153 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-(3,5-dimethylphenyl)imino-5-[(3-hydroxy-4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(/N=C2/NC(=O)C(=Cc3ccc([N+](=O)[O-])c(O)c3)S2)c1 |
| InChI | InChI=1S/C18H15N3O4S/c1-10-5-11(2)7-13(6-10)19-18-20-17(23)16(26-18)9-12-3-4-14(21(24)25)15(22)8-12/h3-9,22H,1-2H3,(H,19,20,23) |
| InChIKey | NDWJTMRJQVFWIE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|