C18H15IN2OS — CID 136844863
(5Z)-2-(3,5-dimethylphenyl)imino-5-[(4-iodophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 136844863) has the molecular formula C18H15IN2OS and a molecular weight of 434.30 g/mol. Its IUPAC name is (5Z)-2-(3,5-dimethylphenyl)imino-5-[(4-iodophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3,5-dimethylphenyl)imino-5-[(4-iodophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136844863 |
| Molecular Formula | C18H15IN2OS |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | (5Z)-2-(3,5-dimethylphenyl)imino-5-[(4-iodophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(/N=C2\NC(=O)/C(=C/c3ccc(I)cc3)S2)c1 |
| InChI | InChI=1S/C18H15IN2OS/c1-11-7-12(2)9-15(8-11)20-18-21-17(22)16(23-18)10-13-3-5-14(19)6-4-13/h3-10H,1-2H3,(H,20,21,22)/b16-10- |
| InChIKey | GGBDAUXYGCFPLT-YBEGLDIGSA-N |
| XLogP | 4.80 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|