C18H13BrN3O4S- — CID 135960933
2-bromo-4-[(Z)-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-nitrophenolate (PubChem CID 135960933) has the molecular formula C18H13BrN3O4S- and a molecular weight of 447.29 g/mol. Its IUPAC name is 2-bromo-4-[(Z)-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-nitrophenolate.
| Compound Name | 2-bromo-4-[(Z)-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 135960933 |
| Molecular Formula | C18H13BrN3O4S- |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | 2-bromo-4-[(Z)-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-nitrophenolate |
| SMILES | Cc1cc(C)cc(/N=C2\NC(=O)/C(=C/c3cc(Br)c([O-])c([N+](=O)[O-])c3)S2)c1 |
| InChI | InChI=1S/C18H14BrN3O4S/c1-9-3-10(2)5-12(4-9)20-18-21-17(24)15(27-18)8-11-6-13(19)16(23)14(7-11)22(25)26/h3-8,23H,1-2H3,(H,20,21,24)/p-1/b15-8- |
| InChIKey | QINHDLJJDWNTFM-NVNXTCNLSA-M |
| XLogP | 3.94 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|