C29H19ClN4O6S2 — CID 137036221
2-chloro-5-[[(5Z)-5-[[4-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanyl-3-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 137036221) has the molecular formula C29H19ClN4O6S2 and a molecular weight of 619.08 g/mol. Its IUPAC name is 2-chloro-5-[[(5Z)-5-[[4-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanyl-3-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 2-chloro-5-[[(5Z)-5-[[4-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanyl-3-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 137036221 |
| Molecular Formula | C29H19ClN4O6S2 |
| Molecular Weight | 619.08 g/mol |
| Exact Mass | 618.04 |
| IUPAC Name | 2-chloro-5-[[(5Z)-5-[[4-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanyl-3-nitrophenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | O=C(CSc1ccc(/C=C2\S/C(=N/c3ccc(Cl)c(C(=O)O)c3)NC2=O)cc1[N+](=O)[O-])Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H19ClN4O6S2/c30-22-9-8-20(14-21(22)28(37)38)32-29-33-27(36)25(42-29)12-16-5-10-24(23(11-16)34(39)40)41-15-26(35)31-19-7-6-17-3-1-2-4-18(17)13-19/h1-14H,15H2,(H,31,35)(H,37,38)(H,32,33,36)/b25-12- |
| InChIKey | WVGBZQCAKPXEKI-ROTLSHHCSA-N |
| XLogP | 6.72 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.08 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|