C20H14N2O3S — CID 135766073
(5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-2-naphthalen-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 135766073) has the molecular formula C20H14N2O3S and a molecular weight of 362.41 g/mol. Its IUPAC name is (5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-2-naphthalen-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-2-naphthalen-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135766073 |
| Molecular Formula | C20H14N2O3S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-2-naphthalen-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc3ccccc3c2)S/C1=C\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H14N2O3S/c23-16-8-5-12(9-17(16)24)10-18-19(25)22-20(26-18)21-15-7-6-13-3-1-2-4-14(13)11-15/h1-11,23-24H,(H,21,22,25)/b18-10- |
| InChIKey | YCPFCQJDPZSXIT-ZDLGFXPLSA-N |
| XLogP | 4.14 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|