C17H11F3N2O3S — CID 135486728
5-[(3,4-dihydroxyphenyl)methylidene]-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 135486728) has the molecular formula C17H11F3N2O3S and a molecular weight of 380.35 g/mol. Its IUPAC name is 5-[(3,4-dihydroxyphenyl)methylidene]-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,4-dihydroxyphenyl)methylidene]-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135486728 |
| Molecular Formula | C17H11F3N2O3S |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 5-[(3,4-dihydroxyphenyl)methylidene]-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccccc2C(F)(F)F)SC1=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H11F3N2O3S/c18-17(19,20)10-3-1-2-4-11(10)21-16-22-15(25)14(26-16)8-9-5-6-12(23)13(24)7-9/h1-8,23-24H,(H,21,22,25) |
| InChIKey | RLUWINUIBBZDKO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|