C30H19N3O4S3 — CID 126000235
2-methyl-N-[2-[2-nitro-4-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 126000235) has the molecular formula C30H19N3O4S3 and a molecular weight of 581.70 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-nitro-4-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | 2-methyl-N-[2-[2-nitro-4-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 126000235 |
| Molecular Formula | C30H19N3O4S3 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.05 |
| IUPAC Name | 2-methyl-N-[2-[2-nitro-4-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc2nc(Sc3ccc(/C=C4\Sc5ccccc5C4=O)cc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C30H19N3O4S3/c1-17-6-2-3-7-20(17)29(35)31-19-11-12-22-26(16-19)40-30(32-22)39-25-13-10-18(14-23(25)33(36)37)15-27-28(34)21-8-4-5-9-24(21)38-27/h2-16H,1H3,(H,31,35)/b27-15- |
| InChIKey | WKKGUFYICQJWAM-DICXZTSXSA-N |
| XLogP | 8.25 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|