C32H21N5O6S2 — CID 126000468
4-methyl-N-[2-[2-nitro-4-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 126000468) has the molecular formula C32H21N5O6S2 and a molecular weight of 635.68 g/mol. Its IUPAC name is 4-methyl-N-[2-[2-nitro-4-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | 4-methyl-N-[2-[2-nitro-4-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 126000468 |
| Molecular Formula | C32H21N5O6S2 |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.09 |
| IUPAC Name | 4-methyl-N-[2-[2-nitro-4-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3nc(Sc4ccc(/C=C5\C(=O)NC(=O)N(c6ccccc6)C5=O)cc4[N+](=O)[O-])sc3c2)cc1 |
| InChI | InChI=1S/C32H21N5O6S2/c1-18-7-10-20(11-8-18)28(38)33-21-12-13-24-27(17-21)45-32(34-24)44-26-14-9-19(16-25(26)37(42)43)15-23-29(39)35-31(41)36(30(23)40)22-5-3-2-4-6-22/h2-17H,1H3,(H,33,38)(H,35,39,41)/b23-15+ |
| InChIKey | XFBRLFNASBSACQ-HZHRSRAPSA-N |
| XLogP | 6.58 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|